|
|
| Nantong Ouk Packaging Engineering Co., Ltd. |
|
|
sea weeds desiccants
|
|
| Detail Description |
Print Page
|
| The main composition ofOUKPAKlimedesiccant is CaO. It absorbs water via chemical reactions. The amount of water absorbed is not related to environmental humidity and the moisture absorbed will not return during evaporation . Response principle:CaO+H2O=Ca(OH)2
|
|
|
| Contact
Details |
|
|
| Contact Person (Department): |
Mr. Ms. Amanda Meng |
| Company Address: |
No.999 Chenggang Road, Nantong,Jiangsu |
| City/Town: |
|
| Province/State: |
|
| Country/Region: |
China |
| Zip/Postal Code: |
226001 |
| Phone Number: |
86-513-85638555 |
| Fax Number: |
86-513-85631168 |
| Homepage: |
|
|
|